C9H14N2O4S — CID 81229467
2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfinyl-2-methylpropanoic acid (PubChem CID 81229467) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfinyl-2-methylpropanoic acid.
| Compound Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81229467 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfinyl-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)CC(=O)NCCC#N |
| InChI | InChI=1S/C9H14N2O4S/c1-9(2,8(13)14)16(15)6-7(12)11-5-3-4-10/h3,5-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | MHHMCARVXPRDLK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|