C12H21NO4 — CID 62932848
5-(3-ethenoxypropylamino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62932848) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 5-(3-ethenoxypropylamino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(3-ethenoxypropylamino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62932848 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 5-(3-ethenoxypropylamino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | C=COCCCNC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C12H21NO4/c1-4-17-7-5-6-13-10(14)8-12(2,3)9-11(15)16/h4H,1,5-9H2,2-3H3,(H,13,14)(H,15,16) |
| InChIKey | ZPLYCFRBXMTJKB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|