C9H14N2O3 — CID 62933397
5-(cyanomethylamino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62933397) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-(cyanomethylamino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(cyanomethylamino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62933397 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 5-(cyanomethylamino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)NCC#N |
| InChI | InChI=1S/C9H14N2O3/c1-9(2,6-8(13)14)5-7(12)11-4-3-10/h4-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | GMYNAQKADIZIIX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|