C13H20N2O4 — CID 116644377
3,3-dimethyl-5-oxo-5-(pent-3-ynylcarbamoylamino)pentanoic acid (PubChem CID 116644377) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-5-(pent-3-ynylcarbamoylamino)pentanoic acid.
| Compound Name | 3,3-dimethyl-5-oxo-5-(pent-3-ynylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 116644377 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3,3-dimethyl-5-oxo-5-(pent-3-ynylcarbamoylamino)pentanoic acid |
| SMILES | CC#CCCNC(=O)NC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-4-5-6-7-14-12(19)15-10(16)8-13(2,3)9-11(17)18/h6-9H2,1-3H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | HZMHMGMMNLFTGZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|