C14H22N2O4 — CID 106213953
5-(hex-5-ynylcarbamoylamino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 106213953) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-(hex-5-ynylcarbamoylamino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(hex-5-ynylcarbamoylamino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106213953 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-(hex-5-ynylcarbamoylamino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | C#CCCCCNC(=O)NC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C14H22N2O4/c1-4-5-6-7-8-15-13(20)16-11(17)9-14(2,3)10-12(18)19/h1H,5-10H2,2-3H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | UAXCCCQZZHTMIB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|