C9H17N3O6S — CID 65300232
2,2-dimethyl-4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid (PubChem CID 65300232) has the molecular formula C9H17N3O6S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid.
| Compound Name | 2,2-dimethyl-4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 65300232 |
| Molecular Formula | C9H17N3O6S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2,2-dimethyl-4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid |
| SMILES | CC(C)(CC(=O)NC(=O)NCCS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O6S/c1-9(2,7(14)15)5-6(13)12-8(16)11-3-4-19(10,17)18/h3-5H2,1-2H3,(H,14,15)(H2,10,17,18)(H2,11,12,13,16) |
| InChIKey | SASFUCNLLNKJLK-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |