C7H15N3O6S — CID 79464472
2-[2-(2-sulfamoylethylcarbamoylamino)ethoxy]acetic acid (PubChem CID 79464472) has the molecular formula C7H15N3O6S and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-[2-(2-sulfamoylethylcarbamoylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(2-sulfamoylethylcarbamoylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79464472 |
| Molecular Formula | C7H15N3O6S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[2-(2-sulfamoylethylcarbamoylamino)ethoxy]acetic acid |
| SMILES | NS(=O)(=O)CCNC(=O)NCCOCC(=O)O |
| InChI | InChI=1S/C7H15N3O6S/c8-17(14,15)4-2-10-7(13)9-1-3-16-5-6(11)12/h1-5H2,(H,11,12)(H2,8,14,15)(H2,9,10,13) |
| InChIKey | IFTPOJJWEMEITK-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|