C9H22ClN3O3S — CID 119704356
2-amino-N-[2-(methanesulfonamido)ethyl]-3-methylpentanamide;hydrochloride (PubChem CID 119704356) has the molecular formula C9H22ClN3O3S and a molecular weight of 287.81 g/mol. Its IUPAC name is 2-amino-N-[2-(methanesulfonamido)ethyl]-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(methanesulfonamido)ethyl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119704356 |
| Molecular Formula | C9H22ClN3O3S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-amino-N-[2-(methanesulfonamido)ethyl]-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NCCNS(C)(=O)=O.Cl |
| InChI | InChI=1S/C9H21N3O3S.ClH/c1-4-7(2)8(10)9(13)11-5-6-12-16(3,14)15;/h7-8,12H,4-6,10H2,1-3H3,(H,11,13);1H |
| InChIKey | BGIIUKMRTHHGER-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|