C9H20N2OS — CID 63958849
(2S)-2-amino-3-methyl-N-(2-methylsulfanylethyl)pentanamide (PubChem CID 63958849) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-(2-methylsulfanylethyl)pentanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-(2-methylsulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 63958849 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-(2-methylsulfanylethyl)pentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)NCCSC |
| InChI | InChI=1S/C9H20N2OS/c1-4-7(2)8(10)9(12)11-5-6-13-3/h7-8H,4-6,10H2,1-3H3,(H,11,12)/t7?,8-/m0/s1 |
| InChIKey | VBSUHRSJSGMGCV-MQWKRIRWSA-N |
| XLogP | 0.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|