C11H22N2OS — CID 103833010
(2S,3S)-2-amino-3-methyl-N-(2-prop-2-enylsulfanylethyl)pentanamide (PubChem CID 103833010) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(2-prop-2-enylsulfanylethyl)pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(2-prop-2-enylsulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 103833010 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(2-prop-2-enylsulfanylethyl)pentanamide |
| SMILES | C=CCSCCNC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C11H22N2OS/c1-4-7-15-8-6-13-11(14)10(12)9(3)5-2/h4,9-10H,1,5-8,12H2,2-3H3,(H,13,14)/t9-,10-/m0/s1 |
| InChIKey | RKZAKDVFXXPKPI-UWVGGRQHSA-N |
| XLogP | 1.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|