C7H13ClN2O2 — CID 62728851
N-(3-amino-3-oxopropyl)-3-chloro-2-methylpropanamide (PubChem CID 62728851) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-3-chloro-2-methylpropanamide.
| Compound Name | N-(3-amino-3-oxopropyl)-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 62728851 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-3-chloro-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)NCCC(N)=O |
| InChI | InChI=1S/C7H13ClN2O2/c1-5(4-8)7(12)10-3-2-6(9)11/h5H,2-4H2,1H3,(H2,9,11)(H,10,12) |
| InChIKey | QPMCQTUSMSWMFJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|