C4H8KNO5S — CID 58995640
potassium 2-acetamido-2-hydroxyethanesulfonate (PubChem CID 58995640) has the molecular formula C4H8KNO5S and a molecular weight of 221.27 g/mol. Its IUPAC name is potassium 2-acetamido-2-hydroxyethanesulfonate.
| Compound Name | potassium 2-acetamido-2-hydroxyethanesulfonate |
|---|---|
| PubChem CID | 58995640 |
| Molecular Formula | C4H8KNO5S |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | potassium 2-acetamido-2-hydroxyethanesulfonate |
| SMILES | CC(=O)NC(O)CS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C4H9NO5S.K/c1-3(6)5-4(7)2-11(8,9)10;/h4,7H,2H2,1H3,(H,5,6)(H,8,9,10);/q;+1/p-1 |
| InChIKey | GXJNQLWCXDMPHR-UHFFFAOYSA-M |
| XLogP | -5.01 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|