C8H14NNaO6S — CID 59439707
sodium 3-hydroxy-2-(2-methylbutanoylamino)-3-oxopropane-1-sulfonate (PubChem CID 59439707) has the molecular formula C8H14NNaO6S and a molecular weight of 275.26 g/mol. Its IUPAC name is sodium 3-hydroxy-2-(2-methylbutanoylamino)-3-oxopropane-1-sulfonate.
| Compound Name | sodium 3-hydroxy-2-(2-methylbutanoylamino)-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 59439707 |
| Molecular Formula | C8H14NNaO6S |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | sodium 3-hydroxy-2-(2-methylbutanoylamino)-3-oxopropane-1-sulfonate |
| SMILES | CCC(C)C(=O)NC(CS(=O)(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C8H15NO6S.Na/c1-3-5(2)7(10)9-6(8(11)12)4-16(13,14)15;/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12)(H,13,14,15);/q;+1/p-1 |
| InChIKey | BJFDYLGOFPMUNR-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|