C10H22NO4S- — CID 158726603
methane;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate (PubChem CID 158726603) has the molecular formula C10H22NO4S- and a molecular weight of 252.36 g/mol. Its IUPAC name is methane;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate.
| Compound Name | methane;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 158726603 |
| Molecular Formula | C10H22NO4S- |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | methane;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate |
| SMILES | C.CCC(C)C(=O)NC(C)(C)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H19NO4S.CH4/c1-5-7(2)8(11)10-9(3,4)6-15(12,13)14;/h7H,5-6H2,1-4H3,(H,10,11)(H,12,13,14);1H4/p-1 |
| InChIKey | IKOQWCYORWLIPM-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|