C20H35N4O7S- — CID 140587524
2-methyl-2-[[2-methyl-4-[[2-methyl-1-(4-methyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]carbamoyl]hexanoyl]amino]propane-1-sulfonate (PubChem CID 140587524) has the molecular formula C20H35N4O7S- and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-methyl-2-[[2-methyl-4-[[2-methyl-1-(4-methyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]carbamoyl]hexanoyl]amino]propane-1-sulfonate.
| Compound Name | 2-methyl-2-[[2-methyl-4-[[2-methyl-1-(4-methyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]carbamoyl]hexanoyl]amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 140587524 |
| Molecular Formula | C20H35N4O7S- |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-methyl-2-[[2-methyl-4-[[2-methyl-1-(4-methyl-2,5-dioxoimidazolidin-4-yl)propan-2-yl]carbamoyl]hexanoyl]amino]propane-1-sulfonate |
| SMILES | CCC(CC(C)C(=O)NC(C)(C)CS(=O)(=O)[O-])C(=O)NC(C)(C)CC1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C20H36N4O7S/c1-8-13(9-12(2)14(25)22-19(5,6)11-32(29,30)31)15(26)23-18(3,4)10-20(7)16(27)21-17(28)24-20/h12-13H,8-11H2,1-7H3,(H,22,25)(H,23,26)(H,29,30,31)(H2,21,24,27,28)/p-1 |
| InChIKey | VTORBDGWAFEFFA-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 173.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|