C18H36N2O2 — CID 90141607
(4R)-2-ethyl-4-methyl-N,N'-bis(2-methylbutan-2-yl)pentanediamide (PubChem CID 90141607) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (4R)-2-ethyl-4-methyl-N,N'-bis(2-methylbutan-2-yl)pentanediamide.
| Compound Name | (4R)-2-ethyl-4-methyl-N,N'-bis(2-methylbutan-2-yl)pentanediamide |
|---|---|
| PubChem CID | 90141607 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (4R)-2-ethyl-4-methyl-N,N'-bis(2-methylbutan-2-yl)pentanediamide |
| SMILES | CCC(C[C@@H](C)C(=O)NC(C)(C)CC)C(=O)NC(C)(C)CC |
| InChI | InChI=1S/C18H36N2O2/c1-9-14(16(22)20-18(7,8)11-3)12-13(4)15(21)19-17(5,6)10-2/h13-14H,9-12H2,1-8H3,(H,19,21)(H,20,22)/t13-,14?/m1/s1 |
| InChIKey | AXZZQOCZJUXDRB-KWCCSABGSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |