C15H31NO — CID 174243287
2-methyl-N-(3,5,5-trimethylheptan-3-yl)butanamide (PubChem CID 174243287) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-methyl-N-(3,5,5-trimethylheptan-3-yl)butanamide.
| Compound Name | 2-methyl-N-(3,5,5-trimethylheptan-3-yl)butanamide |
|---|---|
| PubChem CID | 174243287 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2-methyl-N-(3,5,5-trimethylheptan-3-yl)butanamide |
| SMILES | CCC(C)C(=O)NC(C)(CC)CC(C)(C)CC |
| InChI | InChI=1S/C15H31NO/c1-8-12(4)13(17)16-15(7,10-3)11-14(5,6)9-2/h12H,8-11H2,1-7H3,(H,16,17) |
| InChIKey | YKTMSKSUFASNDX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |