C13H28N2O — CID 43116529
N-(2-methylbutan-2-yl)-2-(2-methylbutan-2-ylamino)propanamide (PubChem CID 43116529) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-2-(2-methylbutan-2-ylamino)propanamide.
| Compound Name | N-(2-methylbutan-2-yl)-2-(2-methylbutan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 43116529 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-(2-methylbutan-2-yl)-2-(2-methylbutan-2-ylamino)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)NC(C)(C)CC |
| InChI | InChI=1S/C13H28N2O/c1-8-12(4,5)14-10(3)11(16)15-13(6,7)9-2/h10,14H,8-9H2,1-7H3,(H,15,16) |
| InChIKey | VPDNICDBDSRECI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |