C12H26N2O2 — CID 83176935
2-(4-hydroxybutan-2-ylamino)-N-(2-methylbutan-2-yl)propanamide (PubChem CID 83176935) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(4-hydroxybutan-2-ylamino)-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-(4-hydroxybutan-2-ylamino)-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 83176935 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-(4-hydroxybutan-2-ylamino)-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)NC(C)CCO |
| InChI | InChI=1S/C12H26N2O2/c1-6-12(4,5)14-11(16)10(3)13-9(2)7-8-15/h9-10,13,15H,6-8H2,1-5H3,(H,14,16) |
| InChIKey | SQBXFMCZYCSPKC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |