C12H26N2O — CID 43087431
N-tert-butyl-2-(2-methylbutan-2-ylamino)propanamide (PubChem CID 43087431) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-tert-butyl-2-(2-methylbutan-2-ylamino)propanamide.
| Compound Name | N-tert-butyl-2-(2-methylbutan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 43087431 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-tert-butyl-2-(2-methylbutan-2-ylamino)propanamide |
| SMILES | CCC(C)(C)NC(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-8-12(6,7)13-9(2)10(15)14-11(3,4)5/h9,13H,8H2,1-7H3,(H,14,15) |
| InChIKey | IXCNWPDEJFGGJA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |