C30H59N3O5 — CID 157215244
N-tert-butyl-4-ethyl-2-methyl-N'-propan-2-ylpentanediamide;butyl 2-methyl-4-(propan-2-ylcarbamoyl)hexanoate (PubChem CID 157215244) has the molecular formula C30H59N3O5 and a molecular weight of 541.82 g/mol. Its IUPAC name is N-tert-butyl-4-ethyl-2-methyl-N'-propan-2-ylpentanediamide;butyl 2-methyl-4-(propan-2-ylcarbamoyl)hexanoate.
| Compound Name | N-tert-butyl-4-ethyl-2-methyl-N'-propan-2-ylpentanediamide;butyl 2-methyl-4-(propan-2-ylcarbamoyl)hexanoate |
|---|---|
| PubChem CID | 157215244 |
| Molecular Formula | C30H59N3O5 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.45 |
| IUPAC Name | N-tert-butyl-4-ethyl-2-methyl-N'-propan-2-ylpentanediamide;butyl 2-methyl-4-(propan-2-ylcarbamoyl)hexanoate |
| SMILES | CCC(CC(C)C(=O)NC(C)(C)C)C(=O)NC(C)C.CCCCOC(=O)C(C)CC(CC)C(=O)NC(C)C |
| InChI | InChI=1S/C15H30N2O2.C15H29NO3/c1-8-12(14(19)16-10(2)3)9-11(4)13(18)17-15(5,6)7;1-6-8-9-19-15(18)12(5)10-13(7-2)14(17)16-11(3)4/h10-12H,8-9H2,1-7H3,(H,16,19)(H,17,18);11-13H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | ASILXWCALODBEC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|