C24H46N2O6 — CID 58586512
1-O-butyl 5-O-(2-hydroxyethyl) 4-[2-[3-(diethylamino)propylcarbamoyl]butyl]-2-methylpentanedioate (PubChem CID 58586512) has the molecular formula C24H46N2O6 and a molecular weight of 458.64 g/mol. Its IUPAC name is 1-O-butyl 5-O-(2-hydroxyethyl) 4-[2-[3-(diethylamino)propylcarbamoyl]butyl]-2-methylpentanedioate.
| Compound Name | 1-O-butyl 5-O-(2-hydroxyethyl) 4-[2-[3-(diethylamino)propylcarbamoyl]butyl]-2-methylpentanedioate |
|---|---|
| PubChem CID | 58586512 |
| Molecular Formula | C24H46N2O6 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 1-O-butyl 5-O-(2-hydroxyethyl) 4-[2-[3-(diethylamino)propylcarbamoyl]butyl]-2-methylpentanedioate |
| SMILES | CCCCOC(=O)C(C)CC(CC(CC)C(=O)NCCCN(CC)CC)C(=O)OCCO |
| InChI | InChI=1S/C24H46N2O6/c1-6-10-15-31-23(29)19(5)17-21(24(30)32-16-14-27)18-20(7-2)22(28)25-12-11-13-26(8-3)9-4/h19-21,27H,6-18H2,1-5H3,(H,25,28) |
| InChIKey | SPQYVLMBRFPCRJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|