C32H56O15 — CID 166057614
pentakis(2-methoxyethyl) 1-methylundecane-1,3,5,7,9-pentacarboxylate (PubChem CID 166057614) has the molecular formula C32H56O15 and a molecular weight of 680.78 g/mol. Its IUPAC name is pentakis(2-methoxyethyl) 1-methylundecane-1,3,5,7,9-pentacarboxylate.
| Compound Name | pentakis(2-methoxyethyl) 1-methylundecane-1,3,5,7,9-pentacarboxylate |
|---|---|
| PubChem CID | 166057614 |
| Molecular Formula | C32H56O15 |
| Molecular Weight | 680.78 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | pentakis(2-methoxyethyl) 1-methylundecane-1,3,5,7,9-pentacarboxylate |
| SMILES | CCC(CC(CC(CC(CC(C)C(=O)OCCOC)C(=O)OCCOC)C(=O)OCCOC)C(=O)OCCOC)C(=O)OCCOC |
| InChI | InChI=1S/C32H56O15/c1-8-24(29(34)44-15-10-39-4)20-26(31(36)46-17-12-41-6)22-27(32(37)47-18-13-42-7)21-25(30(35)45-16-11-40-5)19-23(2)28(33)43-14-9-38-3/h23-27H,8-22H2,1-7H3 |
| InChIKey | USGQPBGLONXCII-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|