C16H30O5 — CID 54187817
1-O-(2-hydroxypropyl) 5-O-(3-methylbutyl) 4-ethyl-2-methylpentanedioate (PubChem CID 54187817) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-O-(2-hydroxypropyl) 5-O-(3-methylbutyl) 4-ethyl-2-methylpentanedioate.
| Compound Name | 1-O-(2-hydroxypropyl) 5-O-(3-methylbutyl) 4-ethyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 54187817 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-O-(2-hydroxypropyl) 5-O-(3-methylbutyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OCC(C)O)C(=O)OCCC(C)C |
| InChI | InChI=1S/C16H30O5/c1-6-14(16(19)20-8-7-11(2)3)9-12(4)15(18)21-10-13(5)17/h11-14,17H,6-10H2,1-5H3 |
| InChIKey | PGIKFAZPMWFKJL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |