C11H20O5 — CID 22892400
1-O-(2-hydroxyethyl) 5-O-methyl 2-ethyl-4-methylpentanedioate (PubChem CID 22892400) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-methyl 2-ethyl-4-methylpentanedioate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-methyl 2-ethyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 22892400 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-methyl 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OC)C(=O)OCCO |
| InChI | InChI=1S/C11H20O5/c1-4-9(11(14)16-6-5-12)7-8(2)10(13)15-3/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | CUEKKCYKXUAORA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |