C18H34O7P+ — CID 121284810
2-[4-carboxy-2-ethyl-7-(2-hydroxyethoxy)-6-methyl-7-oxoheptanoyl]oxyethyl-trimethylphosphanium (PubChem CID 121284810) has the molecular formula C18H34O7P+ and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[4-carboxy-2-ethyl-7-(2-hydroxyethoxy)-6-methyl-7-oxoheptanoyl]oxyethyl-trimethylphosphanium.
| Compound Name | 2-[4-carboxy-2-ethyl-7-(2-hydroxyethoxy)-6-methyl-7-oxoheptanoyl]oxyethyl-trimethylphosphanium |
|---|---|
| PubChem CID | 121284810 |
| Molecular Formula | C18H34O7P+ |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[4-carboxy-2-ethyl-7-(2-hydroxyethoxy)-6-methyl-7-oxoheptanoyl]oxyethyl-trimethylphosphanium |
| SMILES | CCC(CC(CC(C)C(=O)OCCO)C(=O)O)C(=O)OCC[P+](C)(C)C |
| InChI | InChI=1S/C18H33O7P/c1-6-14(18(23)25-9-10-26(3,4)5)12-15(16(20)21)11-13(2)17(22)24-8-7-19/h13-15,19H,6-12H2,1-5H3/p+1 |
| InChIKey | MKSWWZXXHBPZDI-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|