C17H29F3O4 — CID 58426029
1-O-methyl 5-O-(8,8,8-trifluorooctyl) 2-ethyl-4-methylpentanedioate (PubChem CID 58426029) has the molecular formula C17H29F3O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-O-methyl 5-O-(8,8,8-trifluorooctyl) 2-ethyl-4-methylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(8,8,8-trifluorooctyl) 2-ethyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 58426029 |
| Molecular Formula | C17H29F3O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-O-methyl 5-O-(8,8,8-trifluorooctyl) 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OCCCCCCCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C17H29F3O4/c1-4-14(16(22)23-3)12-13(2)15(21)24-11-9-7-5-6-8-10-17(18,19)20/h13-14H,4-12H2,1-3H3 |
| InChIKey | QUGQVGHHKYINGD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|