C20H25F13O4 — CID 58185074
1-O-butyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2-methylpentanedioate (PubChem CID 58185074) has the molecular formula C20H25F13O4 and a molecular weight of 576.39 g/mol. Its IUPAC name is 1-O-butyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2-methylpentanedioate.
| Compound Name | 1-O-butyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 58185074 |
| Molecular Formula | C20H25F13O4 |
| Molecular Weight | 576.39 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-O-butyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCCCOC(=O)C(C)CC(CC)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H25F13O4/c1-4-6-8-36-13(34)11(3)10-12(5-2)14(35)37-9-7-15(21,22)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33/h11-12H,4-10H2,1-3H3 |
| InChIKey | OOUFUPUVWGLXAU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.39 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|