C22H30F11NO5 — CID 58352218
1-O-methyl 7-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-(dimethylcarbamoyl)-6-ethyl-2,2-dimethylheptanedioate (PubChem CID 58352218) has the molecular formula C22H30F11NO5 and a molecular weight of 597.46 g/mol. Its IUPAC name is 1-O-methyl 7-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-(dimethylcarbamoyl)-6-ethyl-2,2-dimethylheptanedioate.
| Compound Name | 1-O-methyl 7-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-(dimethylcarbamoyl)-6-ethyl-2,2-dimethylheptanedioate |
|---|---|
| PubChem CID | 58352218 |
| Molecular Formula | C22H30F11NO5 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 1-O-methyl 7-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-(dimethylcarbamoyl)-6-ethyl-2,2-dimethylheptanedioate |
| SMILES | CCC(CC(CC(C)(C)C(=O)OC)C(=O)N(C)C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H30F11NO5/c1-7-12(10-13(14(35)34(4)5)11-17(2,3)16(37)38-6)15(36)39-9-8-18(23,24)19(25,26)20(27,28)21(29,30)22(31,32)33/h12-13H,7-11H2,1-6H3 |
| InChIKey | FUBVOWZFXPMLEC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|