C10H11F9O3 — CID 99769637
3,3,4,4,5,5,6,6,6-nonafluorohexyl propyl carbonate (PubChem CID 99769637) has the molecular formula C10H11F9O3 and a molecular weight of 350.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl propyl carbonate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl propyl carbonate |
|---|---|
| PubChem CID | 99769637 |
| Molecular Formula | C10H11F9O3 |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl propyl carbonate |
| SMILES | CCCOC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9O3/c1-2-4-21-6(20)22-5-3-7(11,12)8(13,14)9(15,16)10(17,18)19/h2-5H2,1H3 |
| InChIKey | AEOUQJDXCUBINJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|