C10H9F9O2 — CID 124747928
3,3,4,4,5,5,6,6,6-nonafluorohexyl (Z)-but-2-enoate (PubChem CID 124747928) has the molecular formula C10H9F9O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl (Z)-but-2-enoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl (Z)-but-2-enoate |
|---|---|
| PubChem CID | 124747928 |
| Molecular Formula | C10H9F9O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F9O2/c1-2-3-6(20)21-5-4-7(11,12)8(13,14)9(15,16)10(17,18)19/h2-3H,4-5H2,1H3/b3-2- |
| InChIKey | VFWHAQPIJRRWSO-IHWYPQMZSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|