C11H13F9O2 — CID 20727687
3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylbutanoate (PubChem CID 20727687) has the molecular formula C11H13F9O2 and a molecular weight of 348.21 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylbutanoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 20727687 |
| Molecular Formula | C11H13F9O2 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F9O2/c1-3-6(2)7(21)22-5-4-8(12,13)9(14,15)10(16,17)11(18,19)20/h6H,3-5H2,1-2H3 |
| InChIKey | ACZZODGKTFFISQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|