C15H17F13O2 — CID 59693470
3,3,5,5,6,6,7,7,9,9,10,10,10-tridecafluorodecyl 2-methylbutanoate (PubChem CID 59693470) has the molecular formula C15H17F13O2 and a molecular weight of 476.27 g/mol. Its IUPAC name is 3,3,5,5,6,6,7,7,9,9,10,10,10-tridecafluorodecyl 2-methylbutanoate.
| Compound Name | 3,3,5,5,6,6,7,7,9,9,10,10,10-tridecafluorodecyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59693470 |
| Molecular Formula | C15H17F13O2 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 3,3,5,5,6,6,7,7,9,9,10,10,10-tridecafluorodecyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC(F)(F)CC(F)(F)C(F)(F)C(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F13O2/c1-3-8(2)9(29)30-5-4-10(16,17)6-11(18,19)14(24,25)12(20,21)7-13(22,23)15(26,27)28/h8H,3-7H2,1-2H3 |
| InChIKey | CZXIUALWSHUJJH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|