C8H9F7O2 — CID 153303704
1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylbutanoate (PubChem CID 153303704) has the molecular formula C8H9F7O2 and a molecular weight of 270.14 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylbutanoate.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylbutanoate |
|---|---|
| PubChem CID | 153303704 |
| Molecular Formula | C8H9F7O2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7O2/c1-3-4(2)5(16)17-6(9,7(10,11)12)8(13,14)15/h4H,3H2,1-2H3 |
| InChIKey | LAESQWRSJYRPFE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |