About [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate
[1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate (PubChem CID 155645532) has the molecular formula C10H15F3O4
and a molecular weight of 256.22 g/mol. Its IUPAC name is [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate.
Analyze [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate?
The IUPAC name of [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate (CID 155645532) is [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate.
What is the SMILES notation for [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate?
The canonical SMILES for [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate is CCC(C)C(=O)OC(C)C(=O)OCC(F)(F)F.
What is the InChIKey of [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate?
The InChIKey is ZDEKOLIONSXTQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O4/c1-4-6(2)8(14)17-7(3)9(15)16-5-10(11,12)13/h6-7H,4-5H2,1-3H3.
What are the key properties of [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate?
[1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate has a molecular weight of 256.22 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] 2-methylbutanoate is sourced from PubChem (CID 155645532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).