C14H15F13O2 — CID 59693473
2,2,3,3,5,5,6,6,7,7,9,9,9-tridecafluorononyl 2-methylbutanoate (PubChem CID 59693473) has the molecular formula C14H15F13O2 and a molecular weight of 462.25 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6,7,7,9,9,9-tridecafluorononyl 2-methylbutanoate.
| Compound Name | 2,2,3,3,5,5,6,6,7,7,9,9,9-tridecafluorononyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59693473 |
| Molecular Formula | C14H15F13O2 |
| Molecular Weight | 462.25 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2,2,3,3,5,5,6,6,7,7,9,9,9-tridecafluorononyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C14H15F13O2/c1-3-7(2)8(28)29-6-12(21,22)9(15,16)4-10(17,18)14(26,27)11(19,20)5-13(23,24)25/h7H,3-6H2,1-2H3 |
| InChIKey | ABDYLJAJGMVFIR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|