C44H58F12O22 — CID 159925741
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylbutanoate;1-methylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylic acid (PubChem CID 159925741) has the molecular formula C44H58F12O22 and a molecular weight of 1166.90 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylbutanoate;1-methylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylbutanoate;1-methylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylic acid |
|---|---|
| PubChem CID | 159925741 |
| Molecular Formula | C44H58F12O22 |
| Molecular Weight | 1166.90 g/mol |
| Exact Mass | 1166.32 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylbutanoate;1-methylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylic acid |
| SMILES | CCC(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.CCC(CC(CC(CC(CC(CC(CC(CC(CC(CC(C)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C32H46O20.C12H12F12O2/c1-3-14(24(35)36)5-16(26(39)40)7-18(28(43)44)9-20(30(47)48)11-22(32(51)52)12-21(31(49)50)10-19(29(45)46)8-17(27(41)42)6-15(25(37)38)4-13(2)23(33)34;1-3-5(2)6(25)26-4-8(15,16)10(19,20)12(23,24)11(21,22)9(17,18)7(13)14/h13-22H,3-12H2,1-2H3,(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52);5,7H,3-4H2,1-2H3 |
| InChIKey | NYZJNNMSSOQVDR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 399.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|