C12H16F6O4 — CID 126625518
[2-(2,2,3,3,4,4-hexafluoropentoxy)-2-oxoethyl] 2-methylbutanoate (PubChem CID 126625518) has the molecular formula C12H16F6O4 and a molecular weight of 338.24 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4-hexafluoropentoxy)-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-(2,2,3,3,4,4-hexafluoropentoxy)-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 126625518 |
| Molecular Formula | C12H16F6O4 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [2-(2,2,3,3,4,4-hexafluoropentoxy)-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OCC(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H16F6O4/c1-4-7(2)9(20)21-5-8(19)22-6-11(15,16)12(17,18)10(3,13)14/h7H,4-6H2,1-3H3 |
| InChIKey | SRVTUFFODVNIJD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|