C11H11F9O4 — CID 118909062
[2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-2-oxoethyl] 2-methylpropanoate (PubChem CID 118909062) has the molecular formula C11H11F9O4 and a molecular weight of 378.19 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 118909062 |
| Molecular Formula | C11H11F9O4 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-2-oxoethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9O4/c1-5(2)7(22)23-3-6(21)24-4-8(12,13)9(14,15)10(16,17)11(18,19)20/h5H,3-4H2,1-2H3 |
| InChIKey | LBWHQCCONPBZCU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|