C11H15F7O2 — CID 91691554
2,2,3,3,4,4,4-heptafluorobutyl 5-methylhexanoate (PubChem CID 91691554) has the molecular formula C11H15F7O2 and a molecular weight of 312.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 5-methylhexanoate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 5-methylhexanoate |
|---|---|
| PubChem CID | 91691554 |
| Molecular Formula | C11H15F7O2 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F7O2/c1-7(2)4-3-5-8(19)20-6-9(12,13)10(14,15)11(16,17)18/h7H,3-6H2,1-2H3 |
| InChIKey | JENGWYYBQPVMDQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|