C16H23F7O4 — CID 91741460
1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 5-O-(2-methylhexan-3-yl) pentanedioate (PubChem CID 91741460) has the molecular formula C16H23F7O4 and a molecular weight of 412.34 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 5-O-(2-methylhexan-3-yl) pentanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 5-O-(2-methylhexan-3-yl) pentanedioate |
|---|---|
| PubChem CID | 91741460 |
| Molecular Formula | C16H23F7O4 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 5-O-(2-methylhexan-3-yl) pentanedioate |
| SMILES | CCCC(OC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C16H23F7O4/c1-4-6-11(10(2)3)27-13(25)8-5-7-12(24)26-9-14(17,18)15(19,20)16(21,22)23/h10-11H,4-9H2,1-3H3 |
| InChIKey | LKUYMUWIJZSHJM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|