C14H12F14O4 — CID 101326111
bis(2,2,3,3,4,4,4-heptafluorobutyl) 3-methylpentanedioate (PubChem CID 101326111) has the molecular formula C14H12F14O4 and a molecular weight of 510.22 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutyl) 3-methylpentanedioate.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) 3-methylpentanedioate |
|---|---|
| PubChem CID | 101326111 |
| Molecular Formula | C14H12F14O4 |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) 3-methylpentanedioate |
| SMILES | CC(CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F14O4/c1-6(2-7(29)31-4-9(15,16)11(19,20)13(23,24)25)3-8(30)32-5-10(17,18)12(21,22)14(26,27)28/h6H,2-5H2,1H3 |
| InChIKey | JCGIRLQSCQYQTM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|