C9H11ClF7NO3 — CID 42602457
2,2,3,3,4,4,4-heptafluorobutyl 5-amino-4-oxopentanoate;hydrochloride (PubChem CID 42602457) has the molecular formula C9H11ClF7NO3 and a molecular weight of 349.63 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 5-amino-4-oxopentanoate;hydrochloride.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 5-amino-4-oxopentanoate;hydrochloride |
|---|---|
| PubChem CID | 42602457 |
| Molecular Formula | C9H11ClF7NO3 |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 5-amino-4-oxopentanoate;hydrochloride |
| SMILES | Cl.NCC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F7NO3.ClH/c10-7(11,8(12,13)9(14,15)16)4-20-6(19)2-1-5(18)3-17;/h1-4,17H2;1H |
| InChIKey | PLGHHHBLGYMUEP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|