C12H10F12O4 — CID 91734901
4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734901) has the molecular formula C12H10F12O4 and a molecular weight of 446.18 g/mol. Its IUPAC name is 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734901 |
| Molecular Formula | C12H10F12O4 |
| Molecular Weight | 446.18 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F12O4/c13-7(14)9(17,18)3-27-5(25)1-2-6(26)28-4-10(19,20)12(23,24)11(21,22)8(15)16/h7-8H,1-4H2 |
| InChIKey | AQYQPZBRVKSKLO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|