C11H11F9O4 — CID 91727103
5-O-(2,2,3,3,3-pentafluoropropyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91727103) has the molecular formula C11H11F9O4 and a molecular weight of 378.19 g/mol. Its IUPAC name is 5-O-(2,2,3,3,3-pentafluoropropyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 5-O-(2,2,3,3,3-pentafluoropropyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91727103 |
| Molecular Formula | C11H11F9O4 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 5-O-(2,2,3,3,3-pentafluoropropyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H11F9O4/c12-8(13)9(14,15)4-23-6(21)2-1-3-7(22)24-5-10(16,17)11(18,19)20/h8H,1-5H2 |
| InChIKey | ICHHOTZYWAIWRA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|