C17H20F4O4 — CID 91710126
1-O-(3-phenylpropyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91710126) has the molecular formula C17H20F4O4 and a molecular weight of 364.34 g/mol. Its IUPAC name is 1-O-(3-phenylpropyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 1-O-(3-phenylpropyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91710126 |
| Molecular Formula | C17H20F4O4 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-O-(3-phenylpropyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)F)OCCCc1ccccc1 |
| InChI | InChI=1S/C17H20F4O4/c18-16(19)17(20,21)12-25-15(23)10-4-9-14(22)24-11-5-8-13-6-2-1-3-7-13/h1-3,6-7,16H,4-5,8-12H2 |
| InChIKey | DVFQAOKJFYOLNL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|