C16H25ClF4O4 — CID 91709247
1-O-(8-chlorooctyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91709247) has the molecular formula C16H25ClF4O4 and a molecular weight of 392.82 g/mol. Its IUPAC name is 1-O-(8-chlorooctyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 1-O-(8-chlorooctyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91709247 |
| Molecular Formula | C16H25ClF4O4 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-O-(8-chlorooctyl) 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)F)OCCCCCCCCCl |
| InChI | InChI=1S/C16H25ClF4O4/c17-10-5-3-1-2-4-6-11-24-13(22)8-7-9-14(23)25-12-16(20,21)15(18)19/h15H,1-12H2 |
| InChIKey | SPMOJZIGRAGHQA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|