C11H10F10O4 — CID 91739714
1-O-(2,2,3,4,4,4-hexafluorobutyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91739714) has the molecular formula C11H10F10O4 and a molecular weight of 396.18 g/mol. Its IUPAC name is 1-O-(2,2,3,4,4,4-hexafluorobutyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 1-O-(2,2,3,4,4,4-hexafluorobutyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91739714 |
| Molecular Formula | C11H10F10O4 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-O-(2,2,3,4,4,4-hexafluorobutyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)C(F)(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H10F10O4/c12-7(11(19,20)21)9(15,16)3-24-5(22)1-2-6(23)25-4-10(17,18)8(13)14/h7-8H,1-4H2 |
| InChIKey | ADPMFWAGJQXSFD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|