C14H18F6O4 — CID 91694917
5-O-(2,2,3,4,4,4-hexafluorobutyl) 1-O-(3-methylbut-2-enyl) pentanedioate (PubChem CID 91694917) has the molecular formula C14H18F6O4 and a molecular weight of 364.28 g/mol. Its IUPAC name is 5-O-(2,2,3,4,4,4-hexafluorobutyl) 1-O-(3-methylbut-2-enyl) pentanedioate.
| Compound Name | 5-O-(2,2,3,4,4,4-hexafluorobutyl) 1-O-(3-methylbut-2-enyl) pentanedioate |
|---|---|
| PubChem CID | 91694917 |
| Molecular Formula | C14H18F6O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-O-(2,2,3,4,4,4-hexafluorobutyl) 1-O-(3-methylbut-2-enyl) pentanedioate |
| SMILES | CC(C)=CCOC(=O)CCCC(=O)OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O4/c1-9(2)6-7-23-10(21)4-3-5-11(22)24-8-13(16,17)12(15)14(18,19)20/h6,12H,3-5,7-8H2,1-2H3 |
| InChIKey | HWADNWRUFGLELM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|