C12H18Cl2O4 — CID 91694909
5-O-(2,2-dichloroethyl) 1-O-(3-methylbut-2-enyl) pentanedioate (PubChem CID 91694909) has the molecular formula C12H18Cl2O4 and a molecular weight of 297.18 g/mol. Its IUPAC name is 5-O-(2,2-dichloroethyl) 1-O-(3-methylbut-2-enyl) pentanedioate.
| Compound Name | 5-O-(2,2-dichloroethyl) 1-O-(3-methylbut-2-enyl) pentanedioate |
|---|---|
| PubChem CID | 91694909 |
| Molecular Formula | C12H18Cl2O4 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-O-(2,2-dichloroethyl) 1-O-(3-methylbut-2-enyl) pentanedioate |
| SMILES | CC(C)=CCOC(=O)CCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C12H18Cl2O4/c1-9(2)6-7-17-11(15)4-3-5-12(16)18-8-10(13)14/h6,10H,3-5,7-8H2,1-2H3 |
| InChIKey | FWPWPOKNRKZFII-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|